Feedback

comosusol B

PropertiesImageOccurences in reactions
MNX_IDMNXM104004Image of MNXM104004
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC16H22O3
charge0
mass262.15689
referencechebi:67921
InChIKeyLXQUYFOONKATDQ-FPLPWBNLSA-N
InChIInChI=1S/C16H22O3/c1-6-15(2,3)12-10-13(17)11(9-14(12)18)7-8-16(4,5)19/h6-10,17-19H,1H2,2-5H3/b8-7-
SMILESC=CC(C)(C)c1cc(O)c(/C=C\C(C)(C)O)cc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:67921
chebi:67921
comosusol B
2-[(1Z)-3-Hydroxy-3-methyl-1-buten-1-yl]-5-(2-methyl-3-buten-2-yl)-1,4-benzenediol