Feedback

dehydroeburiconic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM104277Image of MNXM104277
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC31H48O3
charge0
mass468.36035
referencechebi:68358
InChIKeyKBZOWVQYHZLSSX-DIQRFASRSA-N
InChIInChI=1S/C31H48O3/c1-19(2)20(3)9-10-21(27(33)34)22-13-17-31(8)24-11-12-25-28(4,5)26(32)15-16-29(25,6)23(24)14-18-30(22,31)7/h19,21-22,25H,3,9-18H2,1-2,4-8H3,(H,33,34)/t21-,22-,25+,29-,30-,31+/m1/s1
SMILESC=C(CC[C@@H](C(=O)O)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC3)C(C)C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:68358
chebi:68358
dehydroeburiconic acid
24-methylidene-3-oxolanost-8-en-21-oic acid
fomefficinic acid A