Feedback

diplotrin B

PropertiesImageOccurences in reactions
MNX_IDMNXM104625Image of MNXM104625
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC19H18O7
charge0
mass358.10525
referencechebi:69448
InChIKeyCKCKGXKRQSDPEV-UHFFFAOYSA-N
InChIInChI=1S/C19H18O7/c1-22-13-7-5-10(9-12(13)20)16-19(25-4)15(21)11-6-8-14(23-2)18(24-3)17(11)26-16/h5-9,20H,1-4H3
SMILESCOc1ccc(-c2oc3c(OC)c(OC)ccc3c(=O)c2OC)cc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:69448
chebi:69448
diplotrin B
2-(3-hydroxy-4-methoxyphenyl)-3,7,8-trimethoxy-4H-chromen-4-one
3'-hydroxy-3,7,8,4'-tetramethoxyflavone