Feedback

N-acetyl-L-glutamate 5-semialdehyde

PropertiesImageOccurences in reactions
MNX_IDMNXM1062Image of MNXM1062
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 7
formulaC7H10NO4
charge-1
mass172.15864
referencechebi:29123
InChIKeyBCPSFKBPHHBDAI-LURJTMIESA-M
InChIInChI=1S/C7H11NO4/c1-5(10)8-6(7(11)12)3-2-4-9/h4,6H,2-3H2,1H3,(H,8,10)(H,11,12)/p-1/t6-/m0/s1
SMILESCC(=O)N[C@@H](CCC=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:29123
chebi:29123
N-acetyl-L-glutamate 5-semialdehyde
(2S)-2-acetamido-5-oxopentanoate
2-Acetamido-5-oxopentanoate
2-acetamido-5-oxopentanoate
2-acetamido-5-oxovalerate
N-Acetyl-L-glutamate 5-semialdehyde
seed.compound:cpd00918
seedM:cpd00918
2-Acetamido-5-oxopentanoate
2-acetamido-5-oxopentanoate
N-Acetyl-L-glutamate 5-semialdehyde
N-acetyl-L-glutamate 5-semialdehyde
N-acetyl-L-glutamate semialdehyde
N-acetyl-L-glutamate-5-semialdehyde
N-acetylglutamate gamma-semialdehyde
N-acetylglutamate semialdehyde
acg5sa
CHEBI:16319
chebi:16319
2-acetamido-5-oxopentanoic acid
(2S)-2-acetamido-5-oxopentanoic acid
2-acetamido-5-oxovaleric acid
N-Acetyl-L-glutamate 5-semialdehyde
N-acetyl-5-oxo-L-norvaline
bigg.metabolite:acg5sa
biggM:acg5sa
N-Acetyl-L-glutamate 5-semialdehyde
hmdb:HMDB0006488 N-Acetyl-L-glutamate 5-semialdehyde
(2S)-2-acetamido-5-oxopentanoic acid
2-acetamido-5-Oxopentanoate
2-acetamido-5-Oxopentanoic acid
2-acetamido-5-Oxovalerate
2-acetamido-5-Oxovaleric acid
N-Acetyl-5-oxo-L-norvaline
N-Acetyl-L-glutamic acid 5-semialdehyde
N-Acetyl-L-glutamic acid gamma-semialdehyde
N-acetyl-5-oxo-L-norvaline
sabiork.compound:2267
sabiorkM:2267
kegg.compound:C01250
keggC:C01250
N-Acetyl-L-glutamate 5-semialdehyde
2-Acetamido-5-oxopentanoate
metacyc.compound:CPD-469
metacycM:CPD-469
N-acetyl-L-glutamate 5-semialdehyde
2-acetamido-5-oxopentanoate
N-acetyl-L-glutamate semialdehyde
N-acetyl-L-glutamate-5-semialdehyde
N-acetylglutamate gamma-semialdehyde
N-acetylglutamate semialdehyde
hmdb:HMDB06488
chebi:11493
chebi:12461
chebi:12577
chebi:21551
chebi:7152
biggM:M_acg5sa
keggC:M_C01250
seedM:M_cpd00918
secondary/obsolete/fantasy identifier