Feedback

N-acetyl-L-glutamate 5-semialdehyde

Properties
MNX_IDMNXM1062
formulaC7H10NO4
charge-1
mass172.15864
referencechebi:29123
Image of MNXM1062
InChIKeyBCPSFKBPHHBDAI-LURJTMIESA-M
InChIInChI=1S/C7H11NO4/c1-5(10)8-6(7(11)12)3-2-4-9/h4,6H,2-3H2,1H3,(H,8,10)(H,11,12)/p-1/t6-/m0/s1
SMILESCC(=O)N[C@@H](CCC=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0006488 N-Acetyl-L-glutamate 5-semialdehyde
(2S)-2-acetamido-5-oxopentanoic acid
2-acetamido-5-Oxopentanoate
2-acetamido-5-Oxopentanoic acid
2-acetamido-5-Oxovalerate
2-acetamido-5-Oxovaleric acid
N-Acetyl-5-oxo-L-norvaline
N-Acetyl-L-glutamic acid 5-semialdehyde
N-Acetyl-L-glutamic acid gamma-semialdehyde
N-acetyl-5-oxo-L-norvaline
metacycM:CPD-469 N-acetyl-L-glutamate 5-semialdehyde
2-acetamido-5-oxopentanoate
N-acetyl-L-glutamate semialdehyde
N-acetyl-L-glutamate-5-semialdehyde
N-acetylglutamate gamma-semialdehyde
N-acetylglutamate semialdehyde
chebi:29123 N-acetyl-L-glutamate 5-semialdehyde
(2S)-2-acetamido-5-oxopentanoate
2-Acetamido-5-oxopentanoate
2-acetamido-5-oxopentanoate
2-acetamido-5-oxovalerate
N-Acetyl-L-glutamate 5-semialdehyde
keggC:C01250
sabiorkM:2267
N-Acetyl-L-glutamate 5-semialdehyde
2-Acetamido-5-oxopentanoate
chebi:16319 2-acetamido-5-oxopentanoic acid
(2S)-2-acetamido-5-oxopentanoic acid
2-acetamido-5-oxovaleric acid
N-Acetyl-L-glutamate 5-semialdehyde
N-acetyl-5-oxo-L-norvaline
seedM:cpd00918 2-Acetamido-5-oxopentanoate
2-acetamido-5-oxopentanoate
N-Acetyl-L-glutamate 5-semialdehyde
N-acetyl-L-glutamate 5-semialdehyde
N-acetyl-L-glutamate semialdehyde
N-acetyl-L-glutamate-5-semialdehyde
N-acetylglutamate gamma-semialdehyde
N-acetylglutamate semialdehyde
acg5sa
biggM:acg5sa N-Acetyl-L-glutamate 5-semialdehyde
biggM:M_acg5sa
chebi:11493
chebi:12461
chebi:12577
chebi:21551
chebi:7152
hmdb:HMDB06488
keggC:M_C01250
seedM:M_cpd00918
secondary/obsolete/fantasy identifier