Feedback

2,5-diamino-6-(1-D-ribitylamino)pyrimidin-4(3H)-one 5'-phosphate

Properties
MNX_IDMNXM1099
formulaC9H16N5O8P
charge-2
mass353.226001
referencechebi:58890
Image of MNXM1099
InChIKeyACIVVGBVOVHFPQ-RPDRRWSUSA-L
InChIInChI=1S/C9H18N5O8P/c10-5-7(13-9(11)14-8(5)18)12-1-3(15)6(17)4(16)2-22-23(19,20)21/h3-4,6,15-17H,1-2,10H2,(H2,19,20,21)(H4,11,12,13,14,18)/p-2/t3-,4+,6-/m0/s1
SMILESNc1nc(NC[C@H](O)[C@H](O)[C@H](O)COP([O-])([O-])=O)c(N)c(=O)[nH]1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models2

Similar chemical compounds in external resources
IdentifierDescription
chebi:52402 2,5-diamino-6-(5-phosphono)ribitylamino-4(3H)-pyrimidinone
1-[(5-amino-6-hydroxy-2-imino-2,3-dihydropyrimidin-4-yl)amino]-1-deoxy-5-O-phosphono-D-ribitol
1-deoxy-1-[(2,5-diamino-6-oxo-1,6-dihydropyrimidin-4-yl)amino]-5-O-phosphono-D-ribitol
2,5-Diamino-6-(1-D-ribitylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-diamino-6-(1-D-ribitylamino)-4(3H)-pyrimidinone 5'-phosphate
2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
metacycM:CPD-10809 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate
chebi:58890 2,5-diamino-6-(1-D-ribitylamino)pyrimidin-4(3H)-one 5'-phosphate
1-deoxy-1-[(2,5-diamino-6-oxo-1,6-dihydropyrimidin-4-yl)amino]-5-O-phosphonato-D-ribitol
2,5-diamino-6-(1-D-ribitylamino)-4(3H)-pyrimidinone 5'-phosphate(2-)
2,5-diamino-6-(1-D-ribitylamino)pyrimidin-4(3H)-one 5'-phosphate(2-)
2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one(2-)
chebi:52957
keggC:M_C18910
secondary/obsolete/fantasy identifier
keggC:C18910 2,5-Diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
2,5-Diamino-6-(1-D-ribitylamino)pyrimidin-4(3H)-one 5'-phosphate