Feedback

3-(2-hydroxyphenyl)propanoate

Properties
MNX_IDMNXM1133
formulaC9H9O3
charge-1
mass165.16596
referencechebi:46957
Image of MNXM1133
InChIKeyCJBDUOMQLFKVQC-UHFFFAOYSA-M
InChIInChI=1S/C9H10O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4,10H,5-6H2,(H,11,12)/p-1
SMILESOc1ccccc1CCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
metacycM:MELILOTATE melilotate
3-(2-Hydroxyphenyl) propionate
3-(2-Hydroxyphenyl)propionic acid
3-(2-hydroxyphenyl)propanoate
3-(o-Hydroxyphenyl) propionic acid
chebi:11719
chebi:1422
chebi:14578
chebi:19921
chebi:19922
hmdb:HMDB33752
keggC:M_C01198
seedM:M_cpd00882
secondary/obsolete/fantasy identifier
chebi:46957 3-(2-hydroxyphenyl)propanoate
2-Hydroxyphenylpropanoate
3-(2-Hydroxyphenyl)propionate
melilotate
chebi:16104 3-(2-hydroxyphenyl)propanoic acid
2-hydroxybenzenepropanoic acid
3-(2-Hydroxyphenyl)propionic acid
3-(2-hydroxyphenyl)propionic acid
3-(o-hydroxyphenyl) propionic acid
melilotic acid
o-Hydroxyphenylpropionic acid
seedM:cpd00882 Melilotate
2-Hydroxyphenylpropanoate
3-(2-Hydroxyphenyl) propionate
3-(2-Hydroxyphenyl)propanoate
3-(2-Hydroxyphenyl)propionate
3-(2-Hydroxyphenyl)propionic acid
3-(2-hydroxyphenyl)propanoate
3-(o-Hydroxyphenyl) propionic acid
melilotate
keggC:C01198 3-(2-Hydroxyphenyl)propanoate
2-Hydroxyphenylpropanoate
3-(2-Hydroxyphenyl)propionate
3-(2-Hydroxyphenyl)propionic acid
Melilotate
envipath:...aa526bd2ff2d 3-(2-Hydroxyphenyl)propionate
hmdb:HMDB0033752 3-(2-Hydroxyphenyl)propanoic acid
2-Hydroxy-benzenepropanoic acid
2-Hydroxybenzenepropanoate
2-Hydroxybenzenepropanoic acid
2-Hydroxybenzenepropanoic acid, 9ci
2-Hydroxyphenylpropanoate
3-(2-Hydroxyphenyl) propanoic acid
3-(2-Hydroxyphenyl) propionate
3-(2-Hydroxyphenyl)propanoate
3-(2-Hydroxyphenyl)propionate
3-(2-Hydroxyphenyl)propionic acid
3-(2-hydroxyphenyl)propanoic acid
3-(O-Hydroxyphenyl) propionate
3-(O-Hydroxyphenyl) propionic acid
3-(O-Hydroxyphenyl)propionic acid, 8ci
Hydrocoumaric acid
Melilotate
Melilotic acid
O-Hydroxyhydrocinnamic acid
O-Hydroxyphenylpropionate
O-Hydroxyphenylpropionic acid
beta -(O-Hydroxyphenyl)propionic acid
beta-(O-Hydroxyphenyl)propionic acid
melilotic acid