Feedback

3-(2-hydroxyphenyl)propanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1133Image of MNXM1133
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC9H9O3
charge-1
mass165.16596
referencechebi:46957
InChIKeyCJBDUOMQLFKVQC-UHFFFAOYSA-M
InChIInChI=1S/C9H10O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4,10H,5-6H2,(H,11,12)/p-1
SMILESOc1ccccc1CCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:46957
chebi:46957
3-(2-hydroxyphenyl)propanoate
2-Hydroxyphenylpropanoate
3-(2-Hydroxyphenyl)propionate
melilotate
kegg.compound:C01198
keggC:C01198
3-(2-Hydroxyphenyl)propanoate
2-Hydroxyphenylpropanoate
3-(2-Hydroxyphenyl)propionate
3-(2-Hydroxyphenyl)propionic acid
Melilotate
hmdb:HMDB0033752 3-(2-Hydroxyphenyl)propanoic acid
2-Hydroxy-benzenepropanoic acid
2-Hydroxybenzenepropanoate
2-Hydroxybenzenepropanoic acid
2-Hydroxybenzenepropanoic acid, 9ci
2-Hydroxyphenylpropanoate
3-(2-Hydroxyphenyl) propanoic acid
3-(2-Hydroxyphenyl) propionate
3-(2-Hydroxyphenyl)propanoate
3-(2-Hydroxyphenyl)propionate
3-(2-Hydroxyphenyl)propionic acid
3-(2-hydroxyphenyl)propanoic acid
3-(O-Hydroxyphenyl) propionate
3-(O-Hydroxyphenyl) propionic acid
3-(O-Hydroxyphenyl)propionic acid, 8ci
Hydrocoumaric acid
Melilotate
Melilotic acid
O-Hydroxyhydrocinnamic acid
O-Hydroxyphenylpropionate
O-Hydroxyphenylpropionic acid
beta -(O-Hydroxyphenyl)propionic acid
beta-(O-Hydroxyphenyl)propionic acid
melilotic acid
envipath:...aa526bd2ff2d
envipathM:...aa526bd2ff2d
3-(2-Hydroxyphenyl)propionate
CHEBI:16104
chebi:16104
3-(2-hydroxyphenyl)propanoic acid
2-hydroxybenzenepropanoic acid
3-(2-Hydroxyphenyl)propionic acid
3-(2-hydroxyphenyl)propionic acid
3-(o-hydroxyphenyl) propionic acid
melilotic acid
o-Hydroxyphenylpropionic acid
seed.compound:cpd00882
seedM:cpd00882
Melilotate
2-Hydroxyphenylpropanoate
3-(2-Hydroxyphenyl) propionate
3-(2-Hydroxyphenyl)propanoate
3-(2-Hydroxyphenyl)propionate
3-(2-Hydroxyphenyl)propionic acid
3-(2-hydroxyphenyl)propanoate
3-(o-Hydroxyphenyl) propionic acid
melilotate
metacyc.compound:MELILOTATE
metacycM:MELILOTATE
melilotate
3-(2-Hydroxyphenyl) propionate
3-(2-Hydroxyphenyl)propionic acid
3-(2-hydroxyphenyl)propanoate
3-(o-Hydroxyphenyl) propionic acid
hmdb:HMDB33752
chebi:11719
chebi:1422
chebi:14578
chebi:19921
chebi:19922
keggC:M_C01198
seedM:M_cpd00882
secondary/obsolete/fantasy identifier