Feedback

9-O-acetylneuraminic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM1220Image of MNXM1220
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC11H19NO9
charge0
mass309.2699
referencechebi:28879
InChIKeyBJOZNDRNJJZHPZ-LUWBGTNYSA-N
InChIInChI=1S/C11H19NO9/c1-4(13)20-3-6(15)8(16)9-7(12)5(14)2-11(19,21-9)10(17)18/h5-9,14-16,19H,2-3,12H2,1H3,(H,17,18)/t5-,6+,7+,8+,9+,11?/m0/s1
SMILESCC(=O)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C[C@H](O)[C@H]1[NH3+])C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-1006168
reactomeM:R-ALL-1006168
reactome:R-ALL-422425
reactomeM:R-ALL-422425
reactome:R-HSA-422427
reactomeM:R-HSA-422427
CHEBI:28879
chebi:28879
9-O-acetylneuraminic acid
9-O-acetyl-5-amino-3,5-dideoxy-D-glycero-D-galacto-non-2-ulopyranosonic acid
O-Acetylated sialic acid
O-Acetylneuraminic acid
seed.compound:cpd02222
seedM:cpd02222
kegg.compound:C03525
keggC:C03525
O-Acetylneuraminic acid
O-Acetylated sialic acid
chebi:21939
chebi:7672
keggC:M_C03525
seedM:M_cpd02222
secondary/obsolete/fantasy identifier