Feedback

 

Dihydroferulic acid 4-O-glucuronide

Image of MNXM124911
Properties
MNX_IDMNXM124911
formulaC16H18O10
charge-2
mass370.3092
referencehmdb:HMDB41723
InChIKeyKYERCTIKYSSKPA-JHZZJYKESA-L
InChIInChI=1S/C16H20O10/c1-24-9-6-7(3-5-10(17)18)2-4-8(9)25-16-13(21)11(19)12(20)14(26-16)15(22)23/h2,4,6,11-14,16,19-21H,3,5H2,1H3,(H,17,18)(H,22,23)/p-2/t11-,12-,13+,14-,16+/m0/s1
SMILESCOc1cc(CCC([O-])=O)ccc1O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of Dihydroferulic acid 4-O-glucuronide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB41723 (2S,3S,4S,5R,6S)-6-[4-(2-carboxyethyl)-2-methoxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid
Dihydroferulic acid 4-O-glucuronide