Feedback

 

Dihydroferulic acid 4-sulfate

Image of MNXM124912
Properties
MNX_IDMNXM124912
formulaC10H10O7S
charge-2
mass274.248
referencehmdb:HMDB41724
InChIKeyUMCDODPBPQMWQP-UHFFFAOYSA-L
InChIInChI=1S/C10H12O7S/c1-16-9-6-7(3-5-10(11)12)2-4-8(9)17-18(13,14)15/h2,4,6H,3,5H2,1H3,(H,11,12)(H,13,14,15)/p-2
SMILESCOc1cc(CCC([O-])=O)ccc1OS([O-])(=O)=O

This chemical compound does not exist in my selection



Occurrences of Dihydroferulic acid 4-sulfate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB41724 3-[3-methoxy-4-(sulfooxy)phenyl]propanoic acid
Dihydroferulic acid 4-sulfate