Feedback

 

Dihydroretrofractamide B

Image of MNXM124937
Properties
MNX_IDMNXM124937
formulaC22H31NO3
charge0
mass357.4864
referencehmdb:HMDB32718
InChIKeyDMIKQRDDTCGOLE-VTKKNFPDSA-N
InChIInChI=1S/C22H31NO3/c1-18(2)16-23-22(24)12-10-8-6-4-3-5-7-9-11-19-13-14-20-21(15-19)26-17-25-20/h6,8,10,12-15,18H,3-5,7,9,11,16-17H2,1-2H3,(H,23,24)/b8-6+,12-10+
SMILESCC(C)CNC(=O)\C=C\C=C\CCCCCCc1ccc2OCOc2c1

This chemical compound does not exist in my selection



Occurrences of Dihydroretrofractamide B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB32718 (2E,4E)-11-(2H-1,3-benzodioxol-5-yl)-N-(2-methylpropyl)undeca-2,4-dienamide
Dihydroretrofractamide B