Feedback

 

Dihydrosinapic acid

Image of MNXM124939
Properties
MNX_IDMNXM124939
formulaC11H13O5
charge-1
mass225.2185
referencehmdb:HMDB41727
InChIKeyBPPVOXVSMSXBEI-UHFFFAOYSA-M
InChIInChI=1S/C11H14O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h5-6,14H,3-4H2,1-2H3,(H,12,13)/p-1
SMILESCOc1cc(CCC([O-])=O)cc(OC)c1O

This chemical compound does not exist in my selection



Occurrences of Dihydrosinapic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB41727 3-(4-hydroxy-3,5-dimethoxyphenyl)propanoic acid
Dihydrosinapic acid