Feedback

 

Dihydrowyerone acid

Image of MNXM124944
Properties
MNX_IDMNXM124944
formulaC14H13O4
charge-1
mass245.2512
referencehmdb:HMDB39493
InChIKeyRZGRQFVNPYQSLD-NTMALXAHSA-M
InChIInChI=1S/C14H14O4/c1-2-3-4-5-6-12(15)13-9-7-11(18-13)8-10-14(16)17/h7-10H,2-4H2,1H3,(H,16,17)/p-1/b10-8-
SMILESCCCCC#CC(=O)c1ccc(\C=C/C([O-])=O)o1

This chemical compound does not exist in my selection



Occurrences of Dihydrowyerone acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB39493 (2Z)-3-[5-(hept-2-ynoyl)furan-2-yl]prop-2-enoic acid
Dihydrowyerone acid