Feedback

 

Dioctyltin isooctylthioglycolate

Image of MNXM124999
Properties
MNX_IDMNXM124999
formulaC36H72O4S2Sn
charge0
mass751.79
referencehmdb:HMDB31615
InChIKeyVXGIVDFKZKMKQO-UHFFFAOYSA-L
InChIInChI=1S/2C10H20O2S.2C8H17.Sn/c2*1-3-5-6-9(4-2)7-12-10(11)8-13;2*1-3-5-7-8-6-4-2;/h2*9,13H,3-8H2,1-2H3;2*1,3-8H2,2H3;/q;;;;+2/p-2
SMILESCCCCCCCC[Sn](CCCCCCCC)(SCC(=O)OCC(CC)CCCC)SCC(=O)OCC(CC)CCCC

This chemical compound does not exist in my selection



Occurrences of Dioctyltin isooctylthioglycolate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB31615 2-ethylhexyl 2-{[({2-[(2-ethylhexyl)oxy]-2-oxoethyl}sulfanyl)dioctylstannyl]sulfanyl}acetate
Dioctyltin isooctylthioglycolate
advastab 17 mok