Feedback

 

Diosbulbin B

Image of MNXM125001
Properties
MNX_IDMNXM125001
formulaC19H20O6
charge0
mass344.3585
referencehmdb:HMDB36777
InChIKeyQEANLIISUSNNDX-UHFFFAOYSA-N
InChIInChI=1S/C19H20O6/c1-18-6-13(9-2-3-22-8-9)25-19(18)7-14(24-17(19)21)15-11-4-10(5-12(15)18)23-16(11)20/h2-3,8,10-15H,4-7H2,1H3
SMILESCC12CC(OC11CC(OC1=O)C1C3CC(CC21)OC3=O)c1ccoc1

This chemical compound does not exist in my selection



Occurrences of Diosbulbin B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB36777 3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.1⁸,¹¹.0¹,⁵.0⁶,¹²]heptadecane-10,15-dione
Diosbulbin B