Feedback

 

Distichonic acid B

Image of MNXM125065
Properties
MNX_IDMNXM125065
formulaC10H17N2O8
charge-1
mass293.2511
referencehmdb:HMDB38753
InChIKeyMQDGZZFOZKWSKP-UHFFFAOYSA-M
InChIInChI=1S/C10H18N2O8/c13-6(10(19)20)1-2-11-5(9(17)18)3-7(14)12-4-8(15)16/h5-7,11-14H,1-4H2,(H,15,16)(H,17,18)(H,19,20)/p-1
SMILESOC(CC([NH2+]CCC(O)C([O-])=O)C([O-])=O)[NH2+]CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of Distichonic acid B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB38753 4-({1-carboxy-3-[(carboxymethyl)amino]-3-hydroxypropyl}amino)-2-hydroxybutanoic acid
Distichonic acid B