Feedback

 

Dukunolide B

Image of MNXM125128
Properties
MNX_IDMNXM125128
formulaC26H26O10
charge0
mass498.4786
referencehmdb:HMDB35664
InChIKeyCDCHBVSDWNDPOE-UHFFFAOYSA-N
InChIInChI=1S/C26H26O10/c1-20(2)19(29)24(30)10-23-12(34-23)5-7-21(3)14(23)13(17(27)33-15(21)11-6-8-32-9-11)25(24,31)22(4)26(20)16(35-26)18(28)36-22/h6,8-9,12,15-16,30-31H,5,7,10H2,1-4H3
SMILESCC12OC(=O)C3OC13C(C)(C)C(=O)C1(O)CC34OC3CCC3(C)C(OC(=O)C(=C43)C21O)c1ccoc1

This chemical compound does not exist in my selection



Occurrences of Dukunolide B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB35664 16-(furan-3-yl)-3,12-dihydroxy-5,5,11,17-tetramethyl-7,10,15,21-tetraoxaheptacyclo[11.8.1.0¹,²⁰.0³,¹².0⁶,⁸.0⁶,¹¹.0¹⁷,²²]docos-13(22)-ene-4,9,14-trione
Dukunolide B