Feedback

 

Dulciol B

Image of MNXM125133
Properties
MNX_IDMNXM125133
formulaC28H31O6
charge-1
mass463.5427
referencehmdb:HMDB29989
InChIKeyCLXFLUDZZDAVOS-UHFFFAOYSA-M
InChIInChI=1S/C28H32O6/c1-8-28(6,7)18-13-19(29)27-21(24(18)32)25(33)20-16(11-9-14(2)3)22(30)23(31)17(26(20)34-27)12-10-15(4)5/h8-10,13,29-32H,1,11-12H2,2-7H3/p-1
SMILESCC(C)=CCc1c(O)c([O-])c(CC=C(C)C)c2oc3c(O)cc(c(O)c3c(=O)c12)C(C)(C)C=C

This chemical compound does not exist in my selection



Occurrences of Dulciol B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB29989 2,3,5,8-tetrahydroxy-1,4-bis(3-methylbut-2-en-1-yl)-7-(2-methylbut-3-en-2-yl)-9H-xanthen-9-one
2,3,5,8-tetrahydroxy-1,4-bis(3-methylbut-2-en-1-yl)-7-(2-methylbut-3-en-2-yl)xanthen-9-one
Dulciol B