Feedback

 

Dulxanthone B

Image of MNXM125138
Properties
MNX_IDMNXM125138
formulaC24H25O6
charge-1
mass409.4522
referencehmdb:HMDB32729
InChIKeySGSSJGOWXOYJNC-UHFFFAOYSA-M
InChIInChI=1S/C24H26O6/c1-12(2)6-8-14-19(26)18-20(27)15-10-11-17(25)21(28)24(15)30-23(18)16(22(14)29-5)9-7-13(3)4/h6-7,10-11,25-26,28H,8-9H2,1-5H3/p-1
SMILESCOc1c(CC=C(C)C)c(O)c2c(oc3c(O)c([O-])ccc3c2=O)c1CC=C(C)C

This chemical compound does not exist in my selection



Occurrences of Dulxanthone B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB32729 1,5,6-trihydroxy-3-methoxy-2,4-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one
1,5,6-trihydroxy-3-methoxy-2,4-bis(3-methylbut-2-en-1-yl)xanthen-9-one
Dulxanthone B