Feedback

 

Dulxanthone G

Image of MNXM125143
Properties
MNX_IDMNXM125143
formulaC22H22O8
charge0
mass414.4053
referencehmdb:HMDB34935
InChIKeyUGQGBKCQHMQDQW-UHFFFAOYSA-N
InChIInChI=1S/C22H22O8/c1-22(2)8-7-10-15(23)14-16(24)13-11(25-3)9-12(26-4)18(27-5)19(13)29-20(14)21(28-6)17(10)30-22/h7-9,23H,1-6H3
SMILESCOc1cc(OC)c2c(oc3c(OC)c4OC(C)(C)C=Cc4c(O)c3c2=O)c1OC

This chemical compound does not exist in my selection



Occurrences of Dulxanthone G in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB34935 5-hydroxy-7,9,10,12-tetramethoxy-2,2-dimethyl-1,11-dioxatetracen-6-one
5-hydroxy-7,9,10,12-tetramethoxy-2,2-dimethyl-2,6-dihydro-1,11-dioxatetracen-6-one
Dulxanthone G