Feedback

 

Elatoside G

Image of MNXM125211
Properties
MNX_IDMNXM125211
formulaC36H54O11
charge-2
mass662.8085
referencehmdb:HMDB41347
InChIKeyUQWJOPVYLXZYCS-UHFFFAOYSA-L
InChIInChI=1S/C36H56O11/c1-31(2)13-14-36(30(44)45)19(15-31)18-7-8-21-32(3)11-10-23(46-29-26(41)24(39)25(40)27(47-29)28(42)43)33(4,17-37)20(32)9-12-34(21,5)35(18,6)16-22(36)38/h7,19-27,29,37-41H,8-17H2,1-6H3,(H,42,43)(H,44,45)/p-2
SMILESCC1(C)CCC2(C(O)CC3(C)C(=CCC4C5(C)CCC(OC6OC(C(O)C(O)C6O)C([O-])=O)C(C)(CO)C5CCC34C)C2C1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of Elatoside G in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB41347 6-{[8a-carboxy-8-hydroxy-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid
6-{[8a-carboxy-8-hydroxy-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid
Elatoside G