Feedback

 

Emblicanin B

Image of MNXM125225
Properties
MNX_IDMNXM125225
formulaC34H18O22
charge-2
mass778.4946
referencehmdb:HMDB30436
InChIKeyJNSDMRUXOVAXNP-UHFFFAOYSA-L
InChIInChI=1S/C34H20O22/c35-10-1-6-15(23(43)19(10)39)16-7(2-11(36)20(40)24(16)44)31(48)54-27-14(5-52-30(6)47)53-34(51)29-28(27)55-32(49)8-3-12(37)21(41)25(45)17(8)18-9(33(50)56-29)4-13(38)22(42)26(18)46/h1-4,14,27,35-46H,5H2/p-2
SMILESOc1cc2c(c(O)c1O)-c1c(O)c(O)c(O)cc1C(=O)OC1C(COC2=O)OC(=O)c2oc(=O)c3cc(O)c(O)c([O-])c3c3c([O-])c(O)c(O)cc3c(=O)oc12

This chemical compound does not exist in my selection



Occurrences of Emblicanin B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB30436 7,8,9,12,13,14,28,29,30,33,34,35-dodecahydroxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.0²,¹⁹.0⁵,¹⁰.0¹¹,¹⁶.0²⁶,³¹.0³²,³⁷]nonatriaconta-2(19),5(10),6,8,11,13,15,26(31),27,29,32,34,36-tridecaene-4,17,20,25,38-pentone
Emblicanin B