Feedback

 

Enokipodin B

Image of MNXM125237
Properties
MNX_IDMNXM125237
formulaC15H18O3
charge0
mass246.3016
referencehmdb:HMDB35902
InChIKeyZDVNWZXSNSTHPK-UHFFFAOYSA-N
InChIInChI=1S/C15H18O3/c1-9-5-13(18)11(6-12(9)17)15(4)8-10(16)7-14(15,2)3/h5-6H,7-8H2,1-4H3
SMILESCC1=CC(=O)C(=CC1=O)C1(C)CC(=O)CC1(C)C

This chemical compound does not exist in my selection



Occurrences of Enokipodin B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB35902 2-methyl-5-(1,2,2-trimethyl-4-oxocyclopentyl)cyclohexa-2,5-diene-1,4-dione
Enokipodin B