Feedback

 

ent-1(10)-Halimene-15,19-dioic acid

Image of MNXM125243
Properties
MNX_IDMNXM125243
formulaC20H30O4
charge-2
mass334.4509
referencehmdb:HMDB39441
InChIKeyRGUIVLSKJWVPDX-UHFFFAOYSA-L
InChIInChI=1S/C20H32O4/c1-13(12-17(21)22)9-11-19(3)14(2)7-8-16-15(19)6-5-10-20(16,4)18(23)24/h6,13-14,16H,5,7-12H2,1-4H3,(H,21,22)(H,23,24)/p-2
SMILESCC(CCC1(C)C(C)CCC2C1=CCCC2(C)C([O-])=O)CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of ent-1(10)-Halimene-15,19-dioic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB39441 5-(4-carboxy-3-methylbutyl)-1,5,6-trimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylic acid
5-(4-carboxy-3-methylbutyl)-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylic acid
ent-1(10)-Halimene-15,19-dioic acid