Feedback

 

ent-15,16-Epoxy-1(10),13(16),14-halimatrien-19-oic acid

Image of MNXM125245
Properties
MNX_IDMNXM125245
formulaC20H27O3
charge-1
mass315.4271
referencehmdb:HMDB39442
InChIKeyULDQVWIHFPQAFF-UHFFFAOYSA-M
InChIInChI=1S/C20H28O3/c1-14-6-7-17-16(5-4-10-20(17,3)18(21)22)19(14,2)11-8-15-9-12-23-13-15/h5,9,12-14,17H,4,6-8,10-11H2,1-3H3,(H,21,22)/p-1
SMILESCC1CCC2C(=CCCC2(C)C([O-])=O)C1(C)CCc1ccoc1

This chemical compound does not exist in my selection



Occurrences of ent-15,16-Epoxy-1(10),13(16),14-halimatrien-19-oic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB39442 5-[2-(furan-3-yl)ethyl]-1,5,6-trimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylic acid
5-[2-(furan-3-yl)ethyl]-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylic acid
ent-15,16-Epoxy-1(10),13(16),14-halimatrien-19-oic acid