Feedback

 

ent-7-Oxo-8(14),15-pimaradien-19-oic acid

Image of MNXM125258
Properties
MNX_IDMNXM125258
formulaC20H27O3
charge-1
mass315.4271
referencehmdb:HMDB36747
InChIKeyTWQIAJPCUCIDQX-UHFFFAOYSA-M
InChIInChI=1S/C20H28O3/c1-5-18(2)10-7-14-13(12-18)15(21)11-16-19(14,3)8-6-9-20(16,4)17(22)23/h5,12,14,16H,1,6-11H2,2-4H3,(H,22,23)/p-1
SMILESCC1(CCC2C(=C1)C(=O)CC1C2(C)CCCC1(C)C([O-])=O)C=C

This chemical compound does not exist in my selection



Occurrences of ent-7-Oxo-8(14),15-pimaradien-19-oic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB36747 7-ethenyl-1,4a,7-trimethyl-9-oxo-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydrophenanthrene-1-carboxylic acid
7-ethenyl-1,4a,7-trimethyl-9-oxo-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid
ent-7-Oxo-8(14),15-pimaradien-19-oic acid