Feedback

 

ent-8(17),13(16),14-Labdatrien-18-oic acid

Image of MNXM125260
Properties
MNX_IDMNXM125260
formulaC20H29O2
charge-1
mass301.4436
referencehmdb:HMDB39486
InChIKeyJEGUVXRNDRXUDN-UHFFFAOYSA-M
InChIInChI=1S/C20H30O2/c1-6-14(2)8-10-16-15(3)9-11-17-19(16,4)12-7-13-20(17,5)18(21)22/h6,16-17H,1-3,7-13H2,4-5H3,(H,21,22)/p-1
SMILESCC12CCCC(C)(C1CCC(=C)C2CCC(=C)C=C)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of ent-8(17),13(16),14-Labdatrien-18-oic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB39486 1,4a-dimethyl-6-methylidene-5-(3-methylidenepent-4-en-1-yl)-decahydronaphthalene-1-carboxylic acid
1,4a-dimethyl-6-methylidene-5-(3-methylidenepent-4-en-1-yl)-hexahydro-2H-naphthalene-1-carboxylic acid
ent-8(17),13(16),14-Labdatrien-18-oic acid