Feedback

 

Epoxyganoderiol B

Image of MNXM125325
Properties
MNX_IDMNXM125325
formulaC30H46O3
charge0
mass454.6844
referencehmdb:HMDB36000
InChIKeyXOBQAKLXNUVCPN-UHFFFAOYSA-N
InChIInChI=1S/C30H46O3/c1-19(8-11-25-30(7,18-31)33-25)20-12-16-29(6)22-9-10-23-26(2,3)24(32)14-15-27(23,4)21(22)13-17-28(20,29)5/h9,13,19-20,23,25,31H,8,10-12,14-18H2,1-7H3
SMILESCC(CCC1OC1(C)CO)C1CCC2(C)C3=CCC4C(C)(C)C(=O)CCC4(C)C3=CCC12C

This chemical compound does not exist in my selection



Occurrences of Epoxyganoderiol B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB36000 14-{4-[3-(hydroxymethyl)-3-methyloxiran-2-yl]butan-2-yl}-2,6,6,11,15-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadeca-1(17),9-dien-5-one
Epoxyganoderiol B