Feedback

 

Erinapyrone B

Image of MNXM125366
Properties
MNX_IDMNXM125366
formulaC7H10O3
charge0
mass142.1525
referencehmdb:HMDB41427
InChIKeyULVSURGNEAHOBK-UHFFFAOYSA-N
InChIInChI=1S/C7H10O3/c1-5-2-6(9)3-7(4-8)10-5/h2,7-8H,3-4H2,1H3
SMILESCC1=CC(=O)CC(CO)O1

This chemical compound does not exist in my selection



Occurrences of Erinapyrone B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB41427 2-(hydroxymethyl)-6-methyl-2,3-dihydropyran-4-one
2-(hydroxymethyl)-6-methyl-3,4-dihydro-2H-pyran-4-one
Erinapyrone B