Feedback

 

Esculentic acid (Phytolacca)

Image of MNXM125414
Properties
MNX_IDMNXM125414
formulaC30H44O6
charge-2
mass500.6679
referencehmdb:HMDB34639
InChIKeyCLXOLTFMHAXJST-UHFFFAOYSA-L
InChIInChI=1S/C30H46O6/c1-25(23(33)34)12-14-30(24(35)36)15-13-28(4)18(19(30)16-25)6-7-21-26(2)10-9-22(32)27(3,17-31)20(26)8-11-29(21,28)5/h6,19-22,31-32H,7-17H2,1-5H3,(H,33,34)(H,35,36)/p-2
SMILESCC1(CCC2(CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(CO)C5CCC34C)C2C1)C([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of Esculentic acid (Phytolacca) in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB34639 10-hydroxy-9-(hydroxymethyl)-2,6a,6b,9,12a-pentamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-2,4a-dicarboxylic acid
10-hydroxy-9-(hydroxymethyl)-2,6a,6b,9,12a-pentamethyl-1,3,4,5,6,7,8,8a,10,11,12,12b,13,14b-tetradecahydropicene-2,4a-dicarboxylic acid
Esculentic acid (Phytolacca)