Feedback

 

Ethoxyacetic acid

Image of MNXM125447
Properties
MNX_IDMNXM125447
formulaC4H7O3
charge-1
mass103.0971
referencehmdb:HMDB31212
InChIKeyYZGQDNOIGFBYKF-UHFFFAOYSA-M
InChIInChI=1S/C4H8O3/c1-2-7-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1
SMILESCCOCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of Ethoxyacetic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB31212 2-ethoxyacetic acid
Ethoxyacetic acid
acetic acid, ethoxy-