Feedback

 

Ethyl hydrogen fumarate

Image of MNXM125522
Properties
MNX_IDMNXM125522
formulaC6H7O4
charge-1
mass143.1179
referencelipidmaps:LMFA07010876
InChIKeyXLYMOEINVGRTEX-ARJAWSKDSA-M
InChIInChI=1S/C6H8O4/c1-2-10-6(9)4-3-5(7)8/h3-4H,2H2,1H3,(H,7,8)/p-1/b4-3-
SMILESCCOC(=O)\C=C/C([O-])=O

This chemical compound does not exist in my selection



Occurrences of Ethyl hydrogen fumarate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB40207 (2Z)-4-ethoxy-4-oxobut-2-enoic acid
Ethyl hydrogen fumarate
lipidmaps:LMFA07010876 (2Z)-4-ethoxy-4-oxobut-2-enoic acid
Ethyl hydrogen fumarate
lipidmaps:LMFA07010876