Feedback

 

ethyl nile blue A

Image of MNXM125533
Properties
MNX_IDMNXM125533
formulaC44H48N6O6S
charge0
mass788.954
referencechebi:52727
InChIKeyUCIQONDPJKEQDP-UHFFFAOYSA-L
InChIInChI=1S/2C22H24N3O.H2O4S/c2*1-4-23-19-14-21-22(17-10-8-7-9-16(17)19)24-18-12-11-15(13-20(18)26-21)25(5-2)6-3;1-5(2,3)4/h2*7-14,23H,4-6H2,1-3H3;(H2,1,2,3,4)/q2*+1;/p-2
SMILES[O-]S([O-])(=O)=O.CCNc1cc2[o+]c3cc(ccc3nc2c2ccccc12)N(CC)CC.CCNc1cc2[o+]c3cc(ccc3nc2c2ccccc12)N(CC)CC

This chemical compound does not exist in my selection



Occurrences of ethyl nile blue A in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:52727 UCIQONDPJKEQDP-UHFFFAOYSA-L
bis[9-(diethylamino)-5-(ethylamino)benzo[a]phenoxazin-7-ium] sulfate
ethyl nile blue A