Feedback

1,3-di-(11Z-eicosenoyl)-2-(7Z,10Z,13Z,16Z,19Z-docosapentaenoyl)-sn-glycerol

PropertiesImageOccurences in reactions
MNX_IDMNXM139420Image of MNXM139420
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC65H112O6
charge0
mass988.84589
referenceslm:000250545
InChIKeyVDXRSXNSQSYFCK-IRZPLBFKSA-N
InChIInChI=1S/C65H112O6/c1-4-7-10-13-16-19-22-25-28-31-32-35-38-41-44-47-50-53-56-59-65(68)71-62(60-69-63(66)57-54-51-48-45-42-39-36-33-29-26-23-20-17-14-11-8-5-2)61-70-64(67)58-55-52-49-46-43-40-37-34-30-27-24-21-18-15-12-9-6-3/h7,10,16,19,25-30,32,35,41,44,62H,4-6,8-9,11-15,17-18,20-24,31,33-34,36-40,42-43,45-61H2,1-3H3/b10-7-,19-16-,28-25-,29-26-,30-27-,35-32-,44-41-
SMILESCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C\CCCCCCCC)COC(=O)CCCCCCCCC/C=C\CCCCCCCC
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
SLM:000250545
slm:000250545
1,3-di-(11Z-eicosenoyl)-2-(7Z,10Z,13Z,16Z,19Z-docosapentaenoyl)-sn-glycerol
TG(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/20:1(11Z))
Triacylglycerol (20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/20:1(11Z))
hmdb:HMDB0050813 TG(20:1(11Z)/22:5(7Z,10Z,13Z,16Z,19Z)/20:1(11Z))
1,3-bis[(11Z)-icos-11-enoyloxy]propan-2-yl (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate
1-(11-Eicosenoyl)-2-(7Z,10Z,13Z,16Z,19Z-docosapentaenoyl)-3-(11-eicosenoyl)-glycerol
1-Eicosenoyl-2-docosapentaenoyl-3-eicosenoyl-glycerol
TAG(20:1/22:5/20:1)
TAG(62:7)
TG(20:1/22:5/20:1)
TG(62:7)
Tracylglycerol(20:1/22:5/20:1)
Tracylglycerol(62:7)
Triacylglycerol
Triglyceride
hmdb:HMDB50813 secondary/obsolete/fantasy identifier