Feedback

(Z)-2-aminobutenoic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM1454Image of MNXM1454
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 0
formulaC4H7NO2
charge0
mass101.10392
referencechebi:18820
InChIKeyPAWSVPVNIXFKOS-IHWYPQMZSA-N
InChIInChI=1S/C4H7NO2/c1-2-3(5)4(6)7/h2H,5H2,1H3,(H,6,7)/b3-2-
SMILESC\C=C(/[NH3+])C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:18820
chebi:18820
(Z)-2-aminobutenoic acid
(2Z)-2-aminobut-2-enoic acid
(Z)-dehydrobutyrine
(Z)2,3-didehydrobutyrine
2-Ammoniobut-2-enoate
alpha,beta-Dehydroaminobutyric acid
anhydrothreonine
metacyc.compound:CPD-15056
metacycM:CPD-15056
(2Z)-2-aminobut-2-enoate
seed.compound:cpd17424
seedM:cpd17424
2-Aminobut-2-enoate
(2Z)-2-Aminobut-2-enoic acid
(2Z)-2-aminobut-2-enoate
(2Z)-2-aminobut-2-enoic acid
2-Ammoniobut-2-enoate
kegg.compound:C17234
keggC:C17234
2-Aminobut-2-enoate
(2Z)-2-Aminobut-2-enoic acid
2-Ammoniobut-2-enoate
CHEBI:58739
chebi:58739
2-aminobut-2-enoate
CHEBI:48306
chebi:48306
2-aminobut-2-enoate
2-aminobut-2-enoic acid zwitterion
2-ammoniobut-2-enoate
2-azaniumylbut-2-enoate
CHEBI:48305
chebi:48305
2-aminobut-2-enoic acid
chebi:58740
chebi:76544
keggC:M_C17234
seedM:M_cpd17424
secondary/obsolete/fantasy identifier