Feedback

(Z)-2-aminobutenoic acid

Properties
MNX_IDMNXM1454
formulaC4H7NO2
charge0
mass101.10392
referencechebi:18820
Image of MNXM1454
InChIKeyPAWSVPVNIXFKOS-IHWYPQMZSA-N
InChIInChI=1S/C4H7NO2/c1-2-3(5)4(6)7/h2H,5H2,1H3,(H,6,7)/b3-2-
SMILESC\C=C(/N)C(O)=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref10
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:48305 2-aminobut-2-enoic acid
metacycM:CPD-15056 (2Z)-2-aminobut-2-enoate
chebi:58739 2-aminobut-2-enoate
chebi:58740
chebi:76544
keggC:M_C17234
seedM:M_cpd17424
secondary/obsolete/fantasy identifier
chebi:48306 2-aminobut-2-enoate
2-aminobut-2-enoic acid zwitterion
2-ammoniobut-2-enoate
2-azaniumylbut-2-enoate
chebi:18820 (Z)-2-aminobutenoic acid
(2Z)-2-aminobut-2-enoic acid
(Z)-dehydrobutyrine
(Z)2,3-didehydrobutyrine
2-Ammoniobut-2-enoate
alpha,beta-Dehydroaminobutyric acid
anhydrothreonine
keggC:C17234 2-Aminobut-2-enoate
(2Z)-2-Aminobut-2-enoic acid
2-Ammoniobut-2-enoate
seedM:cpd17424 2-Aminobut-2-enoate
(2Z)-2-Aminobut-2-enoic acid
(2Z)-2-aminobut-2-enoate
(2Z)-2-aminobut-2-enoic acid
2-Ammoniobut-2-enoate