Feedback

4-pyridoxate

PropertiesImageOccurences in reactions
MNX_IDMNXM1530Image of MNXM1530
#reac
in my sandbox 0
in MNXref (generic)11
in models (compartimentalized) 3
formulaC8H8NO4
charge-1
mass182.15346
referencechebi:30959
InChIKeyHXACOUQIXZGNBF-UHFFFAOYSA-M
InChIInChI=1S/C8H9NO4/c1-4-7(11)6(8(12)13)5(3-10)2-9-4/h2,10-11H,3H2,1H3,(H,12,13)/p-1
SMILESCc1ncc(CO)c(C([O-])=O)c1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30959
chebi:30959
4-pyridoxate
3-hydroxy-5-(hydroxymethyl)-2-methylisonicotinate
3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carboxylate
bigg.metabolite:4pyrdx
biggM:4pyrdx
envipath:...23366537561a
envipathM:...23366537561a
4-Pyridoxate
seed.compound:cpd00631
seedM:cpd00631
4-Pyridoxate
3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carboxylate
4-Pyridoxic acid
4-pyridoxate
4-pyridoxic acid
sabiork.compound:5273
sabiorkM:5273
kegg.compound:C00847
keggC:C00847
4-Pyridoxate
4-Pyridoxic acid
hmdb:HMDB0000017 4-Pyridoxic acid
2-Methyl-3-hydroxy-4-carboxy-5-hydroxymethylpyridine
3-Hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinecarboxylate
3-Hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinecarboxylic acid
3-Hydroxy-5-(hydroxymethyl)-2-methyl-isonicotinate
3-Hydroxy-5-(hydroxymethyl)-2-methyl-isonicotinic acid
3-Hydroxy-5-(hydroxymethyl)-2-methylisonicotinate
3-Hydroxy-5-(hydroxymethyl)-2-methylisonicotinic acid
3-Hydroxy-5-hydroxymethyl-2-methyl-isonicotinate
3-Hydroxy-5-hydroxymethyl-2-methyl-isonicotinic acid
3-Hydroxy-5-hydroxymethyl-2-methyl-isonicotinsaeure
3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carboxylic acid
4 Pyridoxic acid
4 Pyridoxinic acid
4 Pyridoxylic acid
4-Pyridoxate
4-Pyridoxinate
4-Pyridoxinecarboxylate
4-Pyridoxinecarboxylic acid
4-Pyridoxinic acid
4-Pyridoxinsaeure
4-Pyridoxylate
4-Pyridoxylic acid
Pyridoxate
Pyridoxic acid
Pyridoxinecarboxylic acid
pyridoxic acid
metacyc.compound:CPD-1112
metacycM:CPD-1112
4-pyridoxate
3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carboxylate
4-pyridoxic acid
reactome:R-ALL-3204324
reactomeM:R-ALL-3204324
CHEBI:17405
chebi:17405
4-pyridoxic acid
2-methyl-3-hydroxy-4-carboxy-5-hydroxymethylpyridine
3-hydroxy-5-(hydroxymethyl)-2-methylisonicotinic acid
3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carboxylic acid
4-Pyridoxate
4-Pyridoxic acid
4-pyridoxinecarboxylic acid
4-pyridoxinic acid
4-pyridoxylic acid
pyridoxic acid
hmdb:HMDB00017
chebi:12043
chebi:1928
chebi:20473
chebi:20474
biggM:M_4pyrdx
keggC:M_C00847
seedM:M_cpd00631
secondary/obsolete/fantasy identifier