Feedback

quercetin 7-O-alpha-L-rhamnopyranoside

PropertiesImageOccurences in reactions
MNX_IDMNXM160727Image of MNXM160727
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC21H20O11
charge0
mass448.10056
referencechebi:76057
InChIKeyQPHXPNUXTNHJOF-XNFUJFQVSA-N
InChIInChI=1S/C21H20O11/c1-7-15(25)17(27)19(29)21(30-7)31-9-5-12(24)14-13(6-9)32-20(18(28)16(14)26)8-2-3-10(22)11(23)4-8/h2-7,15,17,19,21-25,27-29H,1H3/t7-,15-,17+,19+,21-/m0/s1
SMILESC[C@@H]1O[C@@H](Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc3c2)[C@H](O)[C@H](O)[C@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:76057
chebi:76057
quercetin 7-O-alpha-L-rhamnopyranoside
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxo-4H-chromen-7-yl 6-deoxy-alpha-L-mannopyranoside
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxo-4H-chromen-7-yl alpha-L-rhamnopyranoside
Vincetoxicoside B