Feedback

(R)-malate

PropertiesImageOccurences in reactions
MNX_IDMNXM1608Image of MNXM1608
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 5
formulaC4H4O5
charge-2
mass132.07156
referencechebi:15588
InChIKeyBJEPYKJPYRNKOW-UWTATZPHSA-L
InChIInChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m1/s1
SMILESO[C@H](CC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15588
chebi:15588
(R)-malate
(2R)-2-hydroxybutanedioate
(R)-malate(2-)
D-malate
kegg.compound:C00497
keggC:C00497
(R)-Malate
D-Malate
D-Malic acid
metacyc.compound:CPD-660
metacycM:CPD-660
(R)-malate
D-(+)-malic acid
D-malate
D-malic acid
CHEBI:30796
chebi:30796
(R)-malic acid
(+)-D-malic acid
(2R)-2-hydroxybutanedioic acid
(R)-2-hydroxybutanedioic acid
2-HYDROXY-SUCCINIC ACID
D-Malic acid
D-malic acid
bigg.metabolite:mal__D
biggM:mal__D
D-Malate
seed.compound:cpd00386
seedM:cpd00386
D-Malate
(R)-Malate
(R)-malate
D-(+)-malic acid
D-Malic acid
D-malate
D-malic acid
mal-D
sabiork.compound:2062
sabiorkM:2062
D-Malate
(R)-Malate
D-Malic acid
hmdb:HMDB0031518 D-Malic acid
(+)-D-Malic acid
(2R)-2-hydroxybutanedioic acid
(R)-2-Hydroxybutanedioic acid
(R)-Hydroxybutanedioic acid
.+-.-malic acid
2-HYDROXY-succinIC ACID
D-(+)-Malic acid
D-Hydroxybutanedioic acid
D-Malate
Hydroxy-(R)-butanedioic acid
R-Malic acid
hmdb:HMDB31518
chebi:11002
chebi:18685
chebi:18686
chebi:342
chebi:42060
chebi:44073
biggM:M_mal__D
keggC:M_C00497
seedM:M_cpd00386
secondary/obsolete/fantasy identifier