Feedback

rhod-2(1+)

PropertiesImageOccurences in reactions
MNX_IDMNXM160833Image of MNXM160833
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC52H59N4O19
charge1
mass1043.3768
referencechebi:52892
InChIKeyWVFBOQGCAKHVGN-UHFFFAOYSA-N
InChIInChI=1S/C52H59N4O19/c1-32-10-16-42(55(24-48(61)71-28-67-33(2)57)25-49(62)72-29-68-34(3)58)46(20-32)65-18-19-66-47-21-37(11-17-43(47)56(26-50(63)73-30-69-35(4)59)27-51(64)74-31-70-36(5)60)52-40-14-12-38(53(6)7)22-44(40)75-45-23-39(54(8)9)13-15-41(45)52/h10-17,20-23H,18-19,24-31H2,1-9H3/q+1
SMILESCC(=O)OCOC(=O)CN(CC(=O)OCOC(C)=O)c1ccc(C)cc1OCCOc1cc(-c2c3ccc(=[N+](C)C)cc-3oc3cc(N(C)C)ccc23)ccc1N(CC(=O)OCOC(C)=O)CC(=O)OCOC(C)=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:52892
chebi:52892
rhod-2(1+)
N-[9-(4-{bis[2-(acetoxymethoxy)-2-oxoethyl]amino}-3-[2-(2-{bis[2-(acetoxymethoxy)-2-oxoethyl]amino}-5-methylphenoxy)ethoxy]phenyl)-6-(dimethylamino)-3H-xanthen-3-ylidene]-N-methylmethanaminium
rhod-2 cation