Feedback

Rivanicline galactarate (USAN)

PropertiesImageOccurences in reactions
MNX_IDMNXM160866Image of MNXM160866
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC26H38N4O8
charge0
mass534.26896
referencekeggD:D08987
InChIKeyCIMKLHOSRSGWFB-MWCLJRRUSA-N
InChIInChI=1S/2C10H14N2.C6H10O8/c2*1-11-7-3-2-5-10-6-4-8-12-9-10;7-1(3(9)5(11)12)2(8)4(10)6(13)14/h2*2,4-6,8-9,11H,3,7H2,1H3;1-4,7-10H,(H,11,12)(H,13,14)/b2*5-2+;/t;;1-,2+,3+,4-
SMILESCNCC/C=C/c1cccnc1.CNCC/C=C/c1cccnc1.O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
kegg.drug:D08987
keggD:D08987
Rivanicline galactarate (USAN)
keggD:M_D08987 secondary/obsolete/fantasy identifier