Feedback

sodium succinate hexahydrate

PropertiesImageOccurences in reactions
MNX_IDMNXM161212Image of MNXM161212
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC4H16Na2O10
charge0
mass270.05389
referencechebi:63686
InChIKeyZBTUYCUNQBRXOR-UHFFFAOYSA-L
InChIInChI=1S/C4H6O4.2Na.6H2O/c5-3(6)1-2-4(7)8;;;;;;;;/h1-2H2,(H,5,6)(H,7,8);;;6*1H2/q;2*+1;;;;;;/p-2
SMILESO.O.O.O.O.O.O=C([O-])CCC(=O)[O-].[Na+].[Na+]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:63686
chebi:63686
sodium succinate hexahydrate
Succinic acid disodium salt hexahydrate
disodium butanedioate hexahydrate
disodium butanedioate--water(1/6)
disodium butanedioate.6H2O
disodium succinate hexahydrate
disodium succinate.6H2O
sodium succinate.6H2O