Feedback

Tetrapedic acid A

PropertiesImageOccurences in reactions
MNX_IDMNXM161525Image of MNXM161525
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC20H40O4
charge0
mass344.29266
referencelipidmapsM:LMFA01050426
InChIKeyWKTAZNAFUIUYKK-RTBURBONSA-N
InChIInChI=1S/C20H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-14-18(21)15-13-16-19(22)17-20(23)24/h18-19,21-22H,2-17H2,1H3,(H,23,24)/t18-,19-/m1/s1
SMILESCCCCCCCCCCCCC[C@@H](O)CCC[C@@H](O)CC(=O)O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
lipidmaps:LMFA01050426
lipidmapsM:LMFA01050426
Tetrapedic acid A
3R,7R-dihydroxy-eicosanoic acid
FA 20:0
O2