Feedback

tetrazolium blue

PropertiesImageOccurences in reactions
MNX_IDMNXM161533Image of MNXM161533
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC40H32Cl2N8O2
charge0
mass726.20253
referencechebi:75198
InChIKeyMUUHXGOJWVMBDY-UHFFFAOYSA-L
InChIInChI=1S/C40H32N8O2.2ClH/c1-49-37-27-31(23-25-35(37)47-43-39(29-15-7-3-8-16-29)41-45(47)33-19-11-5-12-20-33)32-24-26-36(38(28-32)50-2)48-44-40(30-17-9-4-10-18-30)42-46(48)34-21-13-6-14-22-34;;/h3-28H,1-2H3;2*1H/q+2;;/p-2
SMILESCOc1cc(-c2ccc(-[n+]3nc(-c4ccccc4)nn3-c3ccccc3)c(OC)c2)ccc1-[n+]1nc(-c2ccccc2)nn1-c1ccccc1.[Cl-].[Cl-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:75198
chebi:75198
tetrazolium blue
3,3'-(3,3'-Dimethoxy-4,4'-biphenylene)bis(2,5-diphenyl-2H-tetrazolium) chloride
3,3'-(3,3'-dimethoxybiphenyl-4,4'-diyl)bis(2,5-diphenyl-2H-tetrazol-3-ium) dichloride
3,3'-Dianisolebis(4,4'-(3,5-diphenyl)tetrazolium chloride)
4-Anisyltetrazolium blue
Blue tetrazolium
Blue tetrazolium chloride
Dimethoxy neotetrazolium
Ditetrazolium chloride