Feedback

thiamine(1+) monophosphate chloride

PropertiesImageOccurences in reactions
MNX_IDMNXM161567Image of MNXM161567
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC12H18ClN4O4PS
charge0
mass380.04749
referencechebi:18338
InChIKeyGUGWNSHJDUEHNJ-UHFFFAOYSA-N
InChIInChI=1S/C12H17N4O4PS.ClH/c1-8-11(3-4-20-21(17,18)19)22-7-16(8)6-10-5-14-9(2)15-12(10)13;/h5,7H,3-4,6H2,1-2H3,(H3-,13,14,15,17,18,19);1H
SMILESCc1ncc(C[n+]2csc(CCOP(=O)(O)O)c2C)c(N)n1.[Cl-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:18338
chebi:18338
thiamine(1+) monophosphate chloride
3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-5-[2-(phosphonooxy)ethyl]-1,3-thiazol-3-ium chloride
Thiamin dihydrogenphosphatchlorid
monofosfotiamina
monophosphoric ester of thiamine
monophosphothiamine
monophosphothiaminum
thiamine monophosphate chloride
vitamin B1 monophosphate chloride
vitamin B1 phosphate chloride
kegg.drug:D08581
keggD:D08581
Monophosphothiamine (INN)
Thiamine monophosphate chloride
chebi:26944
keggD:M_D08581
secondary/obsolete/fantasy identifier