Feedback

Thiamylal sodium

PropertiesImageOccurences in reactions
MNX_IDMNXM161571Image of MNXM161571
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC12H17N2NaO2S
charge0
mass276.09084
referencechebi:9537
InChIKeyLYZGJWXNOGIVQA-UHFFFAOYSA-M
InChIInChI=1S/C12H18N2O2S.Na/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16;/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17);/q;+1/p-1
SMILESC=CCC1(C(C)CCC)C(=O)N=C([S-])NC1=O.[Na+]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:9537
chebi:9537
Thiamylal sodium
Surital
kegg.drug:D00713
keggD:D00713
Thiamylal sodium (JP18)
Surital (TN)
keggD:M_D00713 secondary/obsolete/fantasy identifier