Feedback

tiagabine hydrochloride

PropertiesImageOccurences in reactions
MNX_IDMNXM161617Image of MNXM161617
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC20H26ClNO2S2
charge0
mass411.10935
referencechebi:85388
InChIKeyYUKARLAABCGMCN-PKLMIRHRSA-N
InChIInChI=1S/C20H25NO2S2.ClH/c1-14-7-11-24-18(14)17(19-15(2)8-12-25-19)6-4-10-21-9-3-5-16(13-21)20(22)23;/h6-8,11-12,16H,3-5,9-10,13H2,1-2H3,(H,22,23);1H/t16-;/m1./s1
SMILESCc1ccsc1C(=CCCN1CCC[C@@H](C(=O)O)C1)c1sccc1C.Cl
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:85388
chebi:85388
tiagabine hydrochloride
(-)-(R)-1-(4,4-bis(3-methyl-2-thienyl)-3-butenyl)nipecotic acid hydrochloride
(-)-(R)-1-[4,4-bis(3-methyl-2-thienyl)-3-butenyl]nipecotic acid hydrochloride
(3R)-1-[4,4-bis(3-methyl-2-thienyl)but-3-en-1-yl]-3-carboxypiperidinium chloride
(3R)-1-[4,4-bis(3-methyl-2-thienyl)but-3-en-1-yl]piperidine-3-carboxylic acid hydrochloride
(3R)-1-[4,4-bis(3-methyl-2-thienyl)but-3-en-1-yl]piperidine-3-carboxylic acid monohydrochloride
Abbott 70569.HCl
Abbott-70569.1
Gabitril
tiagabine HCl
tiagabine monohydrochloride
kegg.drug:D02097
keggD:D02097
Tiagabine hydrochloride (USP)
Gabitril (TN)
keggD:M_D02097 secondary/obsolete/fantasy identifier