Feedback

trans-(1R,2S)-sedaxane

PropertiesImageOccurences in reactions
MNX_IDMNXM161736Image of MNXM161736
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC18H19F2N3O
charge0
mass331.14962
referencechebi:83179
InChIKeyXQJQCBDIXRIYRP-CHWSQXEVSA-N
InChIInChI=1S/C18H19F2N3O/c1-23-9-14(16(22-23)17(19)20)18(24)21-15-5-3-2-4-11(15)13-8-12(13)10-6-7-10/h2-5,9-10,12-13,17H,6-8H2,1H3,(H,21,24)/t12-,13-/m1/s1
SMILESCn1cc(C(=O)Nc2ccccc2[C@H]2C[C@@H]2C2CC2)c(C(F)F)n1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:83179
chebi:83179
trans-(1R,2S)-sedaxane
N-{2-[(1R,2S)-1,1'-bi(cyclopropyl)-2-yl]phenyl}-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide