Feedback

trans-2-icosenoic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM161744Image of MNXM161744
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC20H38O2
charge0
mass310.28718
referencechebi:79014
InChIKeyFIKTURVKRGQNQD-VHEBQXMUSA-N
InChIInChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h18-19H,2-17H2,1H3,(H,21,22)/b19-18+
SMILESCCCCCCCCCCCCCCCCC/C=C/C(=O)O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:79014
chebi:79014
trans-2-icosenoic acid
(2E)-2-eicosenoic acid
(2E)-2-icosenoic acid
(2E)-eicos-2-enoic acid
(2E)-icos-2-enoic acid
(E)-2-eicosenoic acid
(E)-2-icosenoic acid