Feedback

tridihexethyl chloride

PropertiesImageOccurences in reactions
MNX_IDMNXM161882Image of MNXM161882
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC21H36ClNO
charge0
mass353.24854
referencechebi:9703
InChIKeyXJGONMZLEDGBRM-UHFFFAOYSA-M
InChIInChI=1S/C21H36NO.ClH/c1-4-22(5-2,6-3)18-17-21(23,19-13-9-7-10-14-19)20-15-11-8-12-16-20;/h7,9-10,13-14,20,23H,4-6,8,11-12,15-18H2,1-3H3;1H/q+1;/p-1
SMILESCC[N+](CC)(CC)CCC(O)(c1ccccc1)C1CCCCC1.[Cl-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:9703
chebi:9703
tridihexethyl chloride
(3-Cyclohexyl-3-hydroxy-3-phenylpropyl)triethylammonium chloride
3-cyclohexyl-N,N,N-triethyl-3-hydroxy-3-phenylpropan-1-aminium chloride
kegg.drug:D00723
keggD:D00723
Tridihexethyl chloride (BAN)
Pathilon (TN)
keggD:M_D00723 secondary/obsolete/fantasy identifier