Feedback

U69593

PropertiesImageOccurences in reactions
MNX_IDMNXM161997Image of MNXM161997
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC22H32N2O2
charge0
mass356.24638
referencechebi:73357
InChIKeyPGZRDDYTKFZSFR-ONTIZHBOSA-N
InChIInChI=1S/C22H32N2O2/c1-23(21(25)16-18-8-3-2-4-9-18)19-10-12-22(11-7-15-26-22)17-20(19)24-13-5-6-14-24/h2-4,8-9,19-20H,5-7,10-17H2,1H3/t19-,20-,22-/m0/s1
SMILESCN(C(=O)Cc1ccccc1)[C@H]1CC[C@@]2(CCCO2)C[C@@H]1N1CCCC1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:73357
chebi:73357
U69593
(5alpha,7alpha,8beta)-(-)-N-methyl-N-(7-(1-pyrrolidinyl)-1-oxaspiro(4.5)dec-8-yl)-benzeneacetamide
N-methyl-2-phenyl-N-[(5R,7S,8S)-7-(pyrrolidin-1-yl)-1-oxaspiro[4.5]dec-8-yl]acetamide
N-methyl-N-((5R,7S,8S)-7-(1-pyrrolidinyl)-1-oxaspiro(4.5)dec-8-yl)-benzeneacetamide
U 69,593
U 69593
U-69593