Feedback

Vanillic acid-4-O-glucuronide

PropertiesImageOccurences in reactions
MNX_IDMNXM162068Image of MNXM162068
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC15H18O9
charge0
mass342.09508
referencechebi:89555
InChIKeyMBNPZIKKKDDLLL-QGZCQISNSA-N
InChIInChI=1S/C15H18O9/c1-6-10(16)11(17)12(14(20)21)24-15(6)23-8-4-3-7(13(18)19)5-9(8)22-2/h3-6,10-12,15-17H,1-2H3,(H,18,19)(H,20,21)/t6-,10-,11+,12+,15-/m1/s1
SMILESCOc1cc(C(=O)O)ccc1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:89555
chebi:89555
Vanillic acid-4-O-glucuronide
(2S,3S,4R,5R,6S)-6-(4-carboxy-2-methoxyphenoxy)-3,4-dihydroxy-5-methyloxane-2-carboxylic acid
hmdb:HMDB0060024 Vanillic acid 4-O-glucuronide
(2S,3S,4S,5R,6S)-6-(4-carboxy-2-methoxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid
3-Methoxy-4-glucuronosidobenzoic acid
4-Carboxy-2-methoxyphenyl beta-D-glucopyranosiduronic acid
4-Carboxy-2-methoxyphenyl beta-D-glucosiduronic acid
Vanillate 4-O-glucuronide
Vanillic acid 4'-O-beta-D-glucuronide
Vanillic acid 4'-O-glucuronide
Vanillic acid 4'-glucuronide
Vanillic acid 4-O-beta-D-glucuronide
Vanillic acid 4-glucuronide
Vanillic acid-4-O-glucuronide
hmdb:HMDB60024 secondary/obsolete/fantasy identifier